C13H23NO3S — CID 107775776
(4,4-dimethylcyclohexyl) (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 107775776) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) (2R)-2-acetamido-3-sulfanylpropanoate.
| Compound Name | (4,4-dimethylcyclohexyl) (2R)-2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 107775776 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (4,4-dimethylcyclohexyl) (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | CC(=O)N[C@@H](CS)C(=O)OC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H23NO3S/c1-9(15)14-11(8-18)12(16)17-10-4-6-13(2,3)7-5-10/h10-11,18H,4-8H2,1-3H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | KLVBKSCFYQFUJH-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|