C14H27NO2 — CID 114341387
(4,4-dimethylcyclohexyl) 2-(aminomethyl)-3-methylbutanoate (PubChem CID 114341387) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) 2-(aminomethyl)-3-methylbutanoate.
| Compound Name | (4,4-dimethylcyclohexyl) 2-(aminomethyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 114341387 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (4,4-dimethylcyclohexyl) 2-(aminomethyl)-3-methylbutanoate |
| SMILES | CC(C)C(CN)C(=O)OC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H27NO2/c1-10(2)12(9-15)13(16)17-11-5-7-14(3,4)8-6-11/h10-12H,5-9,15H2,1-4H3 |
| InChIKey | VSVZUTDRSLEVQI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |