C11H21NO3 — CID 114341418
(4,4-dimethylcyclohexyl) 3-amino-2-hydroxypropanoate (PubChem CID 114341418) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) 3-amino-2-hydroxypropanoate.
| Compound Name | (4,4-dimethylcyclohexyl) 3-amino-2-hydroxypropanoate |
|---|---|
| PubChem CID | 114341418 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (4,4-dimethylcyclohexyl) 3-amino-2-hydroxypropanoate |
| SMILES | CC1(C)CCC(OC(=O)C(O)CN)CC1 |
| InChI | InChI=1S/C11H21NO3/c1-11(2)5-3-8(4-6-11)15-10(14)9(13)7-12/h8-9,13H,3-7,12H2,1-2H3 |
| InChIKey | OQBWZRPRRGFVOM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |