C12H21NO4S — CID 107770067
(3-methoxycyclohexyl) 2-acetamido-3-sulfanylpropanoate (PubChem CID 107770067) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is (3-methoxycyclohexyl) 2-acetamido-3-sulfanylpropanoate.
| Compound Name | (3-methoxycyclohexyl) 2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 107770067 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (3-methoxycyclohexyl) 2-acetamido-3-sulfanylpropanoate |
| SMILES | COC1CCCC(OC(=O)C(CS)NC(C)=O)C1 |
| InChI | InChI=1S/C12H21NO4S/c1-8(14)13-11(7-18)12(15)17-10-5-3-4-9(6-10)16-2/h9-11,18H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | QJMWMGSKZSUSRT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|