C12H21N3O3S — CID 146634485
(E)-N-[2-[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylethyl]but-2-enamide (PubChem CID 146634485) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is (E)-N-[2-[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylethyl]but-2-enamide.
| Compound Name | (E)-N-[2-[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylethyl]but-2-enamide |
|---|---|
| PubChem CID | 146634485 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (E)-N-[2-[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCSC[C@H](NC(C)=O)C(=O)NC |
| InChI | InChI=1S/C12H21N3O3S/c1-4-5-11(17)14-6-7-19-8-10(12(18)13-3)15-9(2)16/h4-5,10H,6-8H2,1-3H3,(H,13,18)(H,14,17)(H,15,16)/b5-4+/t10-/m0/s1 |
| InChIKey | QMXCIVSBMIFWRU-YEZKRMTDSA-N |
| XLogP | -0.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|