C16H20N2O5S — CID 159730958
[4-(2-oxopropyl)phenyl] [(2S)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylformate (PubChem CID 159730958) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is [4-(2-oxopropyl)phenyl] [(2S)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylformate.
| Compound Name | [4-(2-oxopropyl)phenyl] [(2S)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylformate |
|---|---|
| PubChem CID | 159730958 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [4-(2-oxopropyl)phenyl] [(2S)-2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylformate |
| SMILES | CNC(=O)[C@@H](CSC(=O)Oc1ccc(CC(C)=O)cc1)NC(C)=O |
| InChI | InChI=1S/C16H20N2O5S/c1-10(19)8-12-4-6-13(7-5-12)23-16(22)24-9-14(15(21)17-3)18-11(2)20/h4-7,14H,8-9H2,1-3H3,(H,17,21)(H,18,20)/t14-/m1/s1 |
| InChIKey | IVOKLDBWBGDGDO-CQSZACIVSA-N |
| XLogP | 1.30 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|