C14H19N3O6S — CID 163136923
1-[2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene (PubChem CID 163136923) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is 1-[2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene.
| Compound Name | 1-[2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene |
|---|---|
| PubChem CID | 163136923 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[2-acetamido-3-(methylamino)-3-oxopropyl]sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene |
| SMILES | CNC(=O)C(CSC(=O)c1ccc(CO[NH+]([O-])O)cc1)NC(C)=O |
| InChI | InChI=1S/C14H19N3O6S/c1-9(18)16-12(13(19)15-2)8-24-14(20)11-5-3-10(4-6-11)7-23-17(21)22/h3-6,12,17,21H,7-8H2,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | IHKKEGSKAQYENP-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 132.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|