C20H22N2O7S — CID 163180035
1-(2-benzamido-3-ethoxy-3-oxopropyl)sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene (PubChem CID 163180035) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is 1-(2-benzamido-3-ethoxy-3-oxopropyl)sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene.
| Compound Name | 1-(2-benzamido-3-ethoxy-3-oxopropyl)sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene |
|---|---|
| PubChem CID | 163180035 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-(2-benzamido-3-ethoxy-3-oxopropyl)sulfanylcarbonyl-4-[[hydroxy(oxido)azaniumyl]oxymethyl]benzene |
| SMILES | CCOC(=O)C(CSC(=O)c1ccc(CO[NH+]([O-])O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O7S/c1-2-28-19(24)17(21-18(23)15-6-4-3-5-7-15)13-30-20(25)16-10-8-14(9-11-16)12-29-22(26)27/h3-11,17,22,26H,2,12-13H2,1H3,(H,21,23) |
| InChIKey | YTDDYAFOLJGSRI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|