C15H19N3O6S — CID 71676929
S-[(2R)-2-acetamido-3-(dimethylamino)-3-oxopropyl] 4-(nitrooxymethyl)benzenecarbothioate (PubChem CID 71676929) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is S-[(2R)-2-acetamido-3-(dimethylamino)-3-oxopropyl] 4-(nitrooxymethyl)benzenecarbothioate.
| Compound Name | S-[(2R)-2-acetamido-3-(dimethylamino)-3-oxopropyl] 4-(nitrooxymethyl)benzenecarbothioate |
|---|---|
| PubChem CID | 71676929 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | S-[(2R)-2-acetamido-3-(dimethylamino)-3-oxopropyl] 4-(nitrooxymethyl)benzenecarbothioate |
| SMILES | CC(=O)N[C@@H](CSC(=O)c1ccc(CO[N+](=O)[O-])cc1)C(=O)N(C)C |
| InChI | InChI=1S/C15H19N3O6S/c1-10(19)16-13(14(20)17(2)3)9-25-15(21)12-6-4-11(5-7-12)8-24-18(22)23/h4-7,13H,8-9H2,1-3H3,(H,16,19)/t13-/m0/s1 |
| InChIKey | VJFHJPAWPSEAMN-ZDUSSCGKSA-N |
| XLogP | 0.86 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|