C16H21N3O5S — CID 59487539
(4-acetamidophenyl) [(2S)-2-acetamido-3-(dimethylamino)-3-oxopropyl]sulfanylformate (PubChem CID 59487539) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is (4-acetamidophenyl) [(2S)-2-acetamido-3-(dimethylamino)-3-oxopropyl]sulfanylformate.
| Compound Name | (4-acetamidophenyl) [(2S)-2-acetamido-3-(dimethylamino)-3-oxopropyl]sulfanylformate |
|---|---|
| PubChem CID | 59487539 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (4-acetamidophenyl) [(2S)-2-acetamido-3-(dimethylamino)-3-oxopropyl]sulfanylformate |
| SMILES | CC(=O)Nc1ccc(OC(=O)SC[C@@H](NC(C)=O)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H21N3O5S/c1-10(20)17-12-5-7-13(8-6-12)24-16(23)25-9-14(18-11(2)21)15(22)19(3)4/h5-8,14H,9H2,1-4H3,(H,17,20)(H,18,21)/t14-/m1/s1 |
| InChIKey | DJODRSUURIFMCU-CQSZACIVSA-N |
| XLogP | 1.47 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|