C22H32N6O5S — CID 90736103
(4-acetamidophenyl) [2-acetamido-6-amino-6-(N,N-dimethylcarbamimidoyl)imino-4-ethyl-3-oxohexyl]sulfanylformate (PubChem CID 90736103) has the molecular formula C22H32N6O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is (4-acetamidophenyl) [2-acetamido-6-amino-6-(N,N-dimethylcarbamimidoyl)imino-4-ethyl-3-oxohexyl]sulfanylformate.
| Compound Name | (4-acetamidophenyl) [2-acetamido-6-amino-6-(N,N-dimethylcarbamimidoyl)imino-4-ethyl-3-oxohexyl]sulfanylformate |
|---|---|
| PubChem CID | 90736103 |
| Molecular Formula | C22H32N6O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (4-acetamidophenyl) [2-acetamido-6-amino-6-(N,N-dimethylcarbamimidoyl)imino-4-ethyl-3-oxohexyl]sulfanylformate |
| SMILES | [H]/N=C(/N=C(N)CC(CC)C(=O)C(CSC(=O)Oc1ccc(NC(C)=O)cc1)NC(C)=O)N(C)C |
| InChI | InChI=1S/C22H32N6O5S/c1-6-15(11-19(23)27-21(24)28(4)5)20(31)18(26-14(3)30)12-34-22(32)33-17-9-7-16(8-10-17)25-13(2)29/h7-10,15,18H,6,11-12H2,1-5H3,(H,25,29)(H,26,30)(H3,23,24,27) |
| InChIKey | CXBIWLIEYJSSJJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 167.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|