C11H19N3O8S — CID 156615456
(2R)-2-acetamido-3-nitrososulfanyl-N-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]propanamide (PubChem CID 156615456) has the molecular formula C11H19N3O8S and a molecular weight of 353.35 g/mol. Its IUPAC name is (2R)-2-acetamido-3-nitrososulfanyl-N-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]propanamide.
| Compound Name | (2R)-2-acetamido-3-nitrososulfanyl-N-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]propanamide |
|---|---|
| PubChem CID | 156615456 |
| Molecular Formula | C11H19N3O8S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (2R)-2-acetamido-3-nitrososulfanyl-N-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]propanamide |
| SMILES | CC(=O)N[C@@H](CSN=O)C(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C11H19N3O8S/c1-4(16)12-5(3-23-14-21)10(19)13-7-9(18)8(17)6(2-15)22-11(7)20/h5-9,11,15,17-18,20H,2-3H2,1H3,(H,12,16)(H,13,19)/t5-,6+,7+,8+,9+,11-/m0/s1 |
| InChIKey | JUOSQILIKVRXFQ-PFQGKNLYSA-N |
| XLogP | -3.18 |
| TPSA | 177.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|