C16H32N2O6 — CID 158896539
7-methyl-2-(methylamino)-N-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide (PubChem CID 158896539) has the molecular formula C16H32N2O6 and a molecular weight of 348.44 g/mol. Its IUPAC name is 7-methyl-2-(methylamino)-N-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide.
| Compound Name | 7-methyl-2-(methylamino)-N-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide |
|---|---|
| PubChem CID | 158896539 |
| Molecular Formula | C16H32N2O6 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 7-methyl-2-(methylamino)-N-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide |
| SMILES | CNC(CCCCC(C)C)C(=O)NC1[C@H](O)OC(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H32N2O6/c1-9(2)6-4-5-7-10(17-3)15(22)18-12-14(21)13(20)11(8-19)24-16(12)23/h9-14,16-17,19-21,23H,4-8H2,1-3H3,(H,18,22)/t10?,11?,12?,13-,14+,16-/m1/s1 |
| InChIKey | JEXCTFIITPVUAJ-DOUYAYAESA-N |
| XLogP | -1.29 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|