C19H15FN2O6 — CID 9277860
methyl (2S)-2-[[2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxypropanoate (PubChem CID 9277860) has the molecular formula C19H15FN2O6 and a molecular weight of 386.34 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277860 |
| Molecular Formula | C19H15FN2O6 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl (2S)-2-[[2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C19H15FN2O6/c1-28-19(27)15(9-23)21-16(24)10-2-7-13-14(8-10)18(26)22(17(13)25)12-5-3-11(20)4-6-12/h2-8,15,23H,9H2,1H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | MFNWGPUGTWZBAP-HNNXBMFYSA-N |
| XLogP | 0.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|