C20H15FN2O7 — CID 7359771
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7359771) has the molecular formula C20H15FN2O7 and a molecular weight of 414.35 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7359771 |
| Molecular Formula | C20H15FN2O7 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C20H15FN2O7/c1-2-29-20(28)22-16(24)10-30-19(27)11-3-8-14-15(9-11)18(26)23(17(14)25)13-6-4-12(21)5-7-13/h3-9H,2,10H2,1H3,(H,22,24,28) |
| InChIKey | RVWMWFHAHURLDA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|