C12H11F3N2O2 — CID 43753207
2-(4-amino-1,1,1-trifluorobutan-2-yl)isoindole-1,3-dione (PubChem CID 43753207) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-(4-amino-1,1,1-trifluorobutan-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-amino-1,1,1-trifluorobutan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 43753207 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(4-amino-1,1,1-trifluorobutan-2-yl)isoindole-1,3-dione |
| SMILES | NCCC(N1C(=O)c2ccccc2C1=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O2/c13-12(14,15)9(5-6-16)17-10(18)7-3-1-2-4-8(7)11(17)19/h1-4,9H,5-6,16H2 |
| InChIKey | OWXAYCCNBCRCNF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|