C26H22Br2F6N4O2 — CID 167640242
3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;2-[3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]isoindole-1,3-dione (PubChem CID 167640242) has the molecular formula C26H22Br2F6N4O2 and a molecular weight of 696.28 g/mol. Its IUPAC name is 3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;2-[3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]isoindole-1,3-dione.
| Compound Name | 3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;2-[3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167640242 |
| Molecular Formula | C26H22Br2F6N4O2 |
| Molecular Weight | 696.28 g/mol |
| Exact Mass | 694.00 |
| IUPAC Name | 3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;2-[3-(6-bromo-3-pyridinyl)-4,4,4-trifluorobutyl]isoindole-1,3-dione |
| SMILES | NCCC(c1ccc(Br)nc1)C(F)(F)F.O=C1c2ccccc2C(=O)N1CCC(c1ccc(Br)nc1)C(F)(F)F |
| InChI | InChI=1S/C17H12BrF3N2O2.C9H10BrF3N2/c18-14-6-5-10(9-22-14)13(17(19,20)21)7-8-23-15(24)11-3-1-2-4-12(11)16(23)25;10-8-2-1-6(5-15-8)7(3-4-14)9(11,12)13/h1-6,9,13H,7-8H2;1-2,5,7H,3-4,14H2 |
| InChIKey | PBKWRKOPGXOHNS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.28 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|