C22H22BrNO5 — CID 3981769
2-(3-bromophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 3981769) has the molecular formula C22H22BrNO5 and a molecular weight of 460.32 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | 2-(3-bromophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 3981769 |
| Molecular Formula | C22H22BrNO5 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCCOc1cccc(Br)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22BrNO5/c1-14(2)12-19(24-20(25)17-8-3-4-9-18(17)21(24)26)22(27)29-11-10-28-16-7-5-6-15(23)13-16/h3-9,13-14,19H,10-12H2,1-2H3 |
| InChIKey | RWMDERFKXLZSJJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|