C14H12Cl2NO4- — CID 6936156
(2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 6936156) has the molecular formula C14H12Cl2NO4- and a molecular weight of 329.16 g/mol. Its IUPAC name is (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 6936156 |
| Molecular Formula | C14H12Cl2NO4- |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)C[C@H](C(=O)[O-])N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C14H13Cl2NO4/c1-6(2)3-11(14(20)21)17-12(18)7-4-9(15)10(16)5-8(7)13(17)19/h4-6,11H,3H2,1-2H3,(H,20,21)/p-1/t11-/m1/s1 |
| InChIKey | TWODTUQFHQPSOV-LLVKDONJSA-M |
| XLogP | 1.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|