C14H11Cl2NO5 — CID 8752153
2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8752153) has the molecular formula C14H11Cl2NO5 and a molecular weight of 344.15 g/mol. Its IUPAC name is 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8752153 |
| Molecular Formula | C14H11Cl2NO5 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(=O)COC(=O)[C@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C14H11Cl2NO5/c1-6(18)5-22-14(21)7(2)17-12(19)8-3-10(15)11(16)4-9(8)13(17)20/h3-4,7H,5H2,1-2H3/t7-/m0/s1 |
| InChIKey | IARLEUVNQWYUQR-ZETCQYMHSA-N |
| XLogP | 2.11 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|