About 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate
2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8752153) has the molecular formula C14H11Cl2NO5
and a molecular weight of 344.15 g/mol. Its IUPAC name is 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 8752153 |
| Molecular Formula | C14H11Cl2NO5 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(=O)COC(=O)[C@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C14H11Cl2NO5/c1-6(18)5-22-14(21)7(2)17-12(19)8-3-10(15)11(16)4-9(8)13(17)20/h3-4,7H,5H2,1-2H3/t7-/m0/s1 |
| InChIKey | IARLEUVNQWYUQR-ZETCQYMHSA-N |
| XLogP | 2.11 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (CID 8752153) is 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate is CC(=O)COC(=O)[C@H](C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O.
What is the InChIKey of 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is IARLEUVNQWYUQR-ZETCQYMHSA-N. The full InChI is InChI=1S/C14H11Cl2NO5/c1-6(18)5-22-14(21)7(2)17-12(19)8-3-10(15)11(16)4-9(8)13(17)20/h3-4,7H,5H2,1-2H3/t7-/m0/s1.
What are the key properties of 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 344.15 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 8752153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).