C19H16Cl2N2O5S — CID 46610396
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46610396) has the molecular formula C19H16Cl2N2O5S and a molecular weight of 455.32 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46610396 |
| Molecular Formula | C19H16Cl2N2O5S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)N(C)Cc1ccsc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C19H16Cl2N2O5S/c1-10(19(27)28-8-16(24)22(2)7-11-3-4-29-9-11)23-17(25)12-5-14(20)15(21)6-13(12)18(23)26/h3-6,9-10H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | KCNUYMGGGIQKGR-JTQLQIEISA-N |
| XLogP | 3.24 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|