C19H16ClNO4S — CID 8567676
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate (PubChem CID 8567676) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate.
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 8567676 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate |
| SMILES | CN(Cc1ccsc1)C(=O)COC(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H16ClNO4S/c1-21(10-13-8-9-26-12-13)18(22)11-24-19(23)17-7-6-16(25-17)14-4-2-3-5-15(14)20/h2-9,12H,10-11H2,1H3 |
| InChIKey | VTLAOLDWEGLBLK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |