C17H18Cl2N2O5 — CID 55324811
[2-(diethylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55324811) has the molecular formula C17H18Cl2N2O5 and a molecular weight of 401.25 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55324811 |
| Molecular Formula | C17H18Cl2N2O5 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCN(CC)C(=O)COC(=O)C(C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C17H18Cl2N2O5/c1-4-20(5-2)14(22)8-26-17(25)9(3)21-15(23)10-6-12(18)13(19)7-11(10)16(21)24/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | UYYHYIQMCUWJKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|