C22H22N2O5 — CID 8926796
[2-[benzyl(ethyl)amino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926796) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926796 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCN(Cc1ccccc1)C(=O)COC(=O)[C@@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O5/c1-3-23(13-16-9-5-4-6-10-16)19(25)14-29-22(28)15(2)24-20(26)17-11-7-8-12-18(17)21(24)27/h4-12,15H,3,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | FKEYGEDZYIQCNA-OAHLLOKOSA-N |
| XLogP | 2.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|