C16H14Cl2NO3S2- — CID 2185280
(2S)-2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate (PubChem CID 2185280) has the molecular formula C16H14Cl2NO3S2- and a molecular weight of 403.33 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate.
| Compound Name | (2S)-2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 2185280 |
| Molecular Formula | C16H14Cl2NO3S2- |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | (2S)-2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc(Cl)cc2Cl)SC1=S |
| InChI | InChI=1S/C16H15Cl2NO3S2/c1-8(2)5-12(15(21)22)19-14(20)13(24-16(19)23)6-9-3-4-10(17)7-11(9)18/h3-4,6-8,12H,5H2,1-2H3,(H,21,22)/p-1/b13-6-/t12-/m0/s1 |
| InChIKey | QTZKGAGNGPTZCE-CHDKLRHSSA-M |
| XLogP | 3.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|