C14H13Cl2NOS2 — CID 4515021
3-tert-butyl-5-[(2,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4515021) has the molecular formula C14H13Cl2NOS2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 3-tert-butyl-5-[(2,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-tert-butyl-5-[(2,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4515021 |
| Molecular Formula | C14H13Cl2NOS2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 3-tert-butyl-5-[(2,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)N1C(=O)C(=Cc2ccc(Cl)cc2Cl)SC1=S |
| InChI | InChI=1S/C14H13Cl2NOS2/c1-14(2,3)17-12(18)11(20-13(17)19)6-8-4-5-9(15)7-10(8)16/h4-7H,1-3H3 |
| InChIKey | JKPZGEHHOFYUFX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|