C16H16N2O6S2 — CID 3773954
2-[5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid (PubChem CID 3773954) has the molecular formula C16H16N2O6S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid.
| Compound Name | 2-[5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 3773954 |
| Molecular Formula | C16H16N2O6S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C(=Cc2cc([N+](=O)[O-])ccc2O)SC1=S |
| InChI | InChI=1S/C16H16N2O6S2/c1-8(2)5-11(15(21)22)17-14(20)13(26-16(17)25)7-9-6-10(18(23)24)3-4-12(9)19/h3-4,6-8,11,19H,5H2,1-2H3,(H,21,22) |
| InChIKey | OZNSHGKPNHWCRH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|