C17H10N4O7S2 — CID 137120188
(5E)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 137120188) has the molecular formula C17H10N4O7S2 and a molecular weight of 446.42 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137120188 |
| Molecular Formula | C17H10N4O7S2 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (5E)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cc([N+](=O)[O-])ccc2O)SC(=S)N1/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C17H10N4O7S2/c22-13-3-1-11(20(25)26)5-9(13)7-15-16(24)19(17(29)30-15)18-8-10-6-12(21(27)28)2-4-14(10)23/h1-8,22-23H/b15-7+,18-8+ |
| InChIKey | KXNDRLHEBIJAIC-BXTDKPDHSA-N |
| XLogP | 3.15 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|