C19H15N3O6S2 — CID 4757705
5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4757705) has the molecular formula C19H15N3O6S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is 5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4757705 |
| Molecular Formula | C19H15N3O6S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(C=C2SC(=S)N(N=Cc3cc([N+](=O)[O-])ccc3O)C2=O)ccc1O |
| InChI | InChI=1S/C19H15N3O6S2/c1-2-28-16-7-11(3-5-15(16)24)8-17-18(25)21(19(29)30-17)20-10-12-9-13(22(26)27)4-6-14(12)23/h3-10,23-24H,2H2,1H3 |
| InChIKey | NXLSOLVBASIWTE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|