C10H7N3O4S2 — CID 6202465
(5Z)-3-amino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6202465) has the molecular formula C10H7N3O4S2 and a molecular weight of 297.32 g/mol. Its IUPAC name is (5Z)-3-amino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-amino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6202465 |
| Molecular Formula | C10H7N3O4S2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (5Z)-3-amino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | NN1C(=O)/C(=C/c2cc([N+](=O)[O-])ccc2O)SC1=S |
| InChI | InChI=1S/C10H7N3O4S2/c11-12-9(15)8(19-10(12)18)4-5-3-6(13(16)17)1-2-7(5)14/h1-4,14H,11H2/b8-4- |
| InChIKey | ICXUXVALPPNBQK-YWEYNIOJSA-N |
| XLogP | 1.38 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|