C17H11N3O6S2 — CID 27432037
3-hydroxy-N-[(5Z)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 27432037) has the molecular formula C17H11N3O6S2 and a molecular weight of 417.42 g/mol. Its IUPAC name is 3-hydroxy-N-[(5Z)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-hydroxy-N-[(5Z)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 27432037 |
| Molecular Formula | C17H11N3O6S2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 3-hydroxy-N-[(5Z)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2cc([N+](=O)[O-])ccc2O)SC1=S)c1cccc(O)c1 |
| InChI | InChI=1S/C17H11N3O6S2/c21-12-3-1-2-9(7-12)15(23)18-19-16(24)14(28-17(19)27)8-10-6-11(20(25)26)4-5-13(10)22/h1-8,21-22H,(H,18,23)/b14-8- |
| InChIKey | QRQFQPWPHXJKBR-ZSOIEALJSA-N |
| XLogP | 2.55 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|