C17H12N2O5S2 — CID 6236535
N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxybenzamide (PubChem CID 6236535) has the molecular formula C17H12N2O5S2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxybenzamide.
| Compound Name | N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 6236535 |
| Molecular Formula | C17H12N2O5S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxybenzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2ccc(O)c(O)c2)SC1=S)c1cccc(O)c1 |
| InChI | InChI=1S/C17H12N2O5S2/c20-11-3-1-2-10(8-11)15(23)18-19-16(24)14(26-17(19)25)7-9-4-5-12(21)13(22)6-9/h1-8,20-22H,(H,18,23)/b14-7+ |
| InChIKey | HJJRMMLARFAWKI-VGOFMYFVSA-N |
| XLogP | 2.35 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|