C17H11BrN2O4S2 — CID 1365672
2-bromo-N-[5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 1365672) has the molecular formula C17H11BrN2O4S2 and a molecular weight of 451.32 g/mol. Its IUPAC name is 2-bromo-N-[5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-bromo-N-[5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 1365672 |
| Molecular Formula | C17H11BrN2O4S2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 449.93 |
| IUPAC Name | 2-bromo-N-[5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)C(=Cc2ccc(O)c(O)c2)SC1=S)c1ccccc1Br |
| InChI | InChI=1S/C17H11BrN2O4S2/c18-11-4-2-1-3-10(11)15(23)19-20-16(24)14(26-17(20)25)8-9-5-6-12(21)13(22)7-9/h1-8,21-22H,(H,19,23) |
| InChIKey | BVCKOCVNWRECTD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|