C16H11N3O4S2 — CID 135652139
N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide (PubChem CID 135652139) has the molecular formula C16H11N3O4S2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135652139 |
| Molecular Formula | C16H11N3O4S2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2ccc(O)c(O)c2)SC1=S)c1ccncc1 |
| InChI | InChI=1S/C16H11N3O4S2/c20-11-2-1-9(7-12(11)21)8-13-15(23)19(16(24)25-13)18-14(22)10-3-5-17-6-4-10/h1-8,20-21H,(H,18,22)/b13-8+ |
| InChIKey | WUZQUZWADQBUNP-MDWZMJQESA-N |
| XLogP | 2.04 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|