C17H16NO5S2- — CID 7655626
(2S)-2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate (PubChem CID 7655626) has the molecular formula C17H16NO5S2- and a molecular weight of 378.45 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate.
| Compound Name | (2S)-2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 7655626 |
| Molecular Formula | C17H16NO5S2- |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (2S)-2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)[O-])N1C(=O)/C(=C/c2ccc3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C17H17NO5S2/c1-9(2)5-11(16(20)21)18-15(19)14(25-17(18)24)7-10-3-4-12-13(6-10)23-8-22-12/h3-4,6-7,9,11H,5,8H2,1-2H3,(H,20,21)/p-1/b14-7-/t11-/m0/s1 |
| InChIKey | FNZIJXYRYZUAMW-ODYDIQAQSA-M |
| XLogP | 1.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|