C20H17Cl3N2O3 — CID 2901149
N-(2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 2901149) has the molecular formula C20H17Cl3N2O3 and a molecular weight of 439.73 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-(2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 2901149 |
| Molecular Formula | C20H17Cl3N2O3 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | N-(2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)Nc1ccccc1Cl)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C20H17Cl3N2O3/c1-10(2)7-17(18(26)24-16-6-4-3-5-13(16)21)25-19(27)11-8-14(22)15(23)9-12(11)20(25)28/h3-6,8-10,17H,7H2,1-2H3,(H,24,26) |
| InChIKey | ACLDRWOHNQTWPV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|