C14H13N2O6- — CID 2059635
(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 2059635) has the molecular formula C14H13N2O6- and a molecular weight of 305.27 g/mol. Its IUPAC name is (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 2059635 |
| Molecular Formula | C14H13N2O6- |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | CCCC[C@@H](C(=O)[O-])N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C14H14N2O6/c1-2-3-6-10(14(19)20)15-12(17)8-5-4-7-9(16(21)22)11(8)13(15)18/h4-5,7,10H,2-3,6H2,1H3,(H,19,20)/p-1/t10-/m0/s1 |
| InChIKey | OKWNWDANXPWWHI-JTQLQIEISA-M |
| XLogP | 0.50 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|