C18H11ClN2O7 — CID 1295643
[2-(2-chlorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 1295643) has the molecular formula C18H11ClN2O7 and a molecular weight of 402.75 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 1295643 |
| Molecular Formula | C18H11ClN2O7 |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H11ClN2O7/c19-12-6-2-1-4-10(12)14(22)9-28-15(23)8-20-17(24)11-5-3-7-13(21(26)27)16(11)18(20)25/h1-7H,8-9H2 |
| InChIKey | ZKNIWXLVDJRIET-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|