C16H8Cl2N2O6 — CID 2707349
(2,3-dichlorophenyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 2707349) has the molecular formula C16H8Cl2N2O6 and a molecular weight of 395.15 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (2,3-dichlorophenyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 2707349 |
| Molecular Formula | C16H8Cl2N2O6 |
| Molecular Weight | 395.15 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | (2,3-dichlorophenyl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H8Cl2N2O6/c17-9-4-2-6-11(14(9)18)26-12(21)7-19-15(22)8-3-1-5-10(20(24)25)13(8)16(19)23/h1-6H,7H2 |
| InChIKey | LVZGPTWOWQNHFK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|