C17H15N3O2 — CID 125044412
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanimidamide (PubChem CID 125044412) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanimidamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 125044412 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanimidamide |
| SMILES | [H]/N=C(\N)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H15N3O2/c18-15(19)14(10-11-6-2-1-3-7-11)20-16(21)12-8-4-5-9-13(12)17(20)22/h1-9,14H,10H2,(H3,18,19)/t14-/m0/s1 |
| InChIKey | DYIWQOXKOMXSHY-AWEZNQCLSA-N |
| XLogP | 1.83 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|