C18H16N2O3 — CID 134821366
methyl (2S)-2-(1-imino-3-oxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 134821366) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is methyl (2S)-2-(1-imino-3-oxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-(1-imino-3-oxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 134821366 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl (2S)-2-(1-imino-3-oxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | [H]/N=C1\c2ccccc2C(=O)N1[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H16N2O3/c1-23-18(22)15(11-12-7-3-2-4-8-12)20-16(19)13-9-5-6-10-14(13)17(20)21/h2-10,15,19H,11H2,1H3/b19-16+/t15-/m0/s1 |
| InChIKey | AGJCZZMDNSAHJN-NXSRCCIVSA-N |
| XLogP | 2.25 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|