C26H24N2O3 — CID 8928431
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-3-phenyl-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 8928431) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-3-phenyl-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-3-phenyl-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 8928431 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-3-phenyl-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | C[C@@H](c1ccccc1)N(C)C(=O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H24N2O3/c1-18(20-13-7-4-8-14-20)27(2)26(31)23(17-19-11-5-3-6-12-19)28-24(29)21-15-9-10-16-22(21)25(28)30/h3-16,18,23H,17H2,1-2H3/t18-,23-/m0/s1 |
| InChIKey | RRYVNEPNFJIANU-MBSDFSHPSA-N |
| XLogP | 4.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|