C19H27N2O3S+ — CID 8772895
ethyl 1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8772895) has the molecular formula C19H27N2O3S+ and a molecular weight of 363.50 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8772895 |
| Molecular Formula | C19H27N2O3S+ |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | ethyl 1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidin-1-ium-4-carboxylate |
| SMILES | C=CCSc1ccccc1NC(=O)C[NH+]1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H26N2O3S/c1-3-13-25-17-8-6-5-7-16(17)20-18(22)14-21-11-9-15(10-12-21)19(23)24-4-2/h3,5-8,15H,1,4,9-14H2,2H3,(H,20,22)/p+1 |
| InChIKey | CZSPONKGEGBECX-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|