C22H34BrN3O3S — CID 92682266
1-[(4-bromophenyl)methylsulfonyl]-N-[3-(4-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 92682266) has the molecular formula C22H34BrN3O3S and a molecular weight of 500.50 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methylsulfonyl]-N-[3-(4-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methylsulfonyl]-N-[3-(4-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92682266 |
| Molecular Formula | C22H34BrN3O3S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 1-[(4-bromophenyl)methylsulfonyl]-N-[3-(4-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)C2CCN(S(=O)(=O)Cc3ccc(Br)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H34BrN3O3S/c1-18-7-13-25(14-8-18)12-2-11-24-22(27)20-9-15-26(16-10-20)30(28,29)17-19-3-5-21(23)6-4-19/h3-6,18,20H,2,7-17H2,1H3,(H,24,27) |
| InChIKey | CVHTVCDLNSQXTG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|