C24H32N2O — CID 94024759
1-[(3-methylphenyl)methyl]-N-[(1R)-1-(4-methylphenyl)propyl]piperidine-4-carboxamide (PubChem CID 94024759) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-N-[(1R)-1-(4-methylphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-methylphenyl)methyl]-N-[(1R)-1-(4-methylphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 94024759 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-N-[(1R)-1-(4-methylphenyl)propyl]piperidine-4-carboxamide |
| SMILES | CC[C@@H](NC(=O)C1CCN(Cc2cccc(C)c2)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H32N2O/c1-4-23(21-10-8-18(2)9-11-21)25-24(27)22-12-14-26(15-13-22)17-20-7-5-6-19(3)16-20/h5-11,16,22-23H,4,12-15,17H2,1-3H3,(H,25,27)/t23-/m1/s1 |
| InChIKey | VMJVPSFFSMJPQT-HSZRJFAPSA-N |
| XLogP | 4.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |