C22H27ClN2OS — CID 43920667
1-[(3-chlorophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide (PubChem CID 43920667) has the molecular formula C22H27ClN2OS and a molecular weight of 402.99 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43920667 |
| Molecular Formula | C22H27ClN2OS |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)C2CCCN(Cc3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H27ClN2OS/c1-17-7-9-21(10-8-17)27-13-11-24-22(26)19-5-3-12-25(16-19)15-18-4-2-6-20(23)14-18/h2,4,6-10,14,19H,3,5,11-13,15-16H2,1H3,(H,24,26) |
| InChIKey | ABNVZQWWYIJIIT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|