C24H27BrN4O2S — CID 43932422
1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide (PubChem CID 43932422) has the molecular formula C24H27BrN4O2S and a molecular weight of 515.48 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43932422 |
| Molecular Formula | C24H27BrN4O2S |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)C2CCCN(Cc3nc(-c4cccc(Br)c4)no3)C2)cc1 |
| InChI | InChI=1S/C24H27BrN4O2S/c1-17-7-9-21(10-8-17)32-13-11-26-24(30)19-5-3-12-29(15-19)16-22-27-23(28-31-22)18-4-2-6-20(25)14-18/h2,4,6-10,14,19H,3,5,11-13,15-16H2,1H3,(H,26,30) |
| InChIKey | LKWZSVIMJJIORL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|