C24H27ClN4O3S — CID 43930782
N-[2-(4-chlorophenyl)sulfanylethyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide (PubChem CID 43930782) has the molecular formula C24H27ClN4O3S and a molecular weight of 487.03 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43930782 |
| Molecular Formula | C24H27ClN4O3S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(-c2noc(CN3CCCC(C(=O)NCCSc4ccc(Cl)cc4)C3)n2)cc1 |
| InChI | InChI=1S/C24H27ClN4O3S/c1-31-20-8-4-17(5-9-20)23-27-22(32-28-23)16-29-13-2-3-18(15-29)24(30)26-12-14-33-21-10-6-19(25)7-11-21/h4-11,18H,2-3,12-16H2,1H3,(H,26,30) |
| InChIKey | QTMCXAJVCKMFOI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|