C24H27ClN4O2S — CID 43929356
N-[3-(4-chlorophenyl)sulfanylpropyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 43929356) has the molecular formula C24H27ClN4O2S and a molecular weight of 471.03 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)sulfanylpropyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(4-chlorophenyl)sulfanylpropyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43929356 |
| Molecular Formula | C24H27ClN4O2S |
| Molecular Weight | 471.03 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[3-(4-chlorophenyl)sulfanylpropyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCSc1ccc(Cl)cc1)C1CCCN(Cc2nc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C24H27ClN4O2S/c25-20-9-11-21(12-10-20)32-15-5-13-26-24(30)19-8-4-14-29(16-19)17-22-27-23(28-31-22)18-6-2-1-3-7-18/h1-3,6-7,9-12,19H,4-5,8,13-17H2,(H,26,30) |
| InChIKey | PMOBEUWNEBKIBI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.03 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|