C22H26Cl2N2OS — CID 45012752
1-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 45012752) has the molecular formula C22H26Cl2N2OS and a molecular weight of 437.44 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45012752 |
| Molecular Formula | C22H26Cl2N2OS |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1cccc(Cl)c1)C1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H26Cl2N2OS/c23-20-6-3-4-17(14-20)16-28-13-10-25-22(27)18-8-11-26(12-9-18)15-19-5-1-2-7-21(19)24/h1-7,14,18H,8-13,15-16H2,(H,25,27) |
| InChIKey | QCWBFMFISUZSMS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|